ITA0636
ITA0636
- Catalog: ITA0636
- Gene/Protein: EIF4EBP1
- Product Description: Immunotag™ Phospho-4EBP1(Ser65/Thr70) Antibody
385.0000
Price in reward points: 385
| Antibody Specification | |
| Datasheet |
|
| Target Protein | Phospho-4EBP1(Ser65/Thr70) |
| Clonality | Polyclonal |
| Storage/Stability | -20°C/1 year |
| Application | WB,IHC |
| Recommended Dilution | WB 1:500-1:2000, IHC 1:50-1:200 |
| Concentration | 1 mg/ml |
| Reactive Species | Human,Mouse,Rat |
| Host Species | Rabbit |
| Immunogen | A synthesized peptide derived from human 4EBP1 around the phosphorylation site of Ser65/Thr70. |
| Specificity | Phospho-4EBP1(Ser65/Thr70) Antibody detects endogenous levels of 4EBP1. |
| Purification | The antibody is from purified rabbit serum by affinity purification via sequential chromatography on phospho- and non-phospho-peptide affinity columns. |
| Form | Rabbit IgG in phosphate buffered saline , pH 7.4, 150mM NaCl, 0.02% sodium azide and 50% glycerol.Store at -20 °C.Stable for 12 months from date of receipt |
| Gene Name | EIF4EBP1 |
| Accession No. | Q13541 |
| Alternate Names | 4E-BP1; 4EBP1; 4EBP1_HUMAN; BP 1; eIF4E binding protein 1; eIF4E-binding protein 1; Eif4ebp1; Eukaryotic translation initiation factor 4E-binding protein 1; PHAS-I; PHASI; Phosphorylated heat- and acid-stable protein regulated by insulin 1; |
| Description | Repressor of translation initiation that regulates EIF4E activity by preventing its assembly into the eIF4F complex: hypophosphorylated form competes with EIF4G1/EIF4G3 and strongly binds to EIF4E, leading to repress translation. In contrast, hyperphosphorylated form dissociates from EIF4E, allowing interaction between EIF4G1/EIF4G3 and EIF4E, leading to initiation of translation. Mediates the regulation of protein translation by hormones, growth factors and other stimuli that signal through the MAP kinase and mTORC1 pathways. |
| Cell Pathway/ Category | Primary Polyclonal Antibody |
| Protein MW | 15 to 20kDa |
| Usage | For Research Use Only! Not for diagnostic or therapeutic procedures. |
| Material Safety Data Sheet | |
| English_US |
|
| Danish |
|
| Dutch |
|
| English_UK |
|
| French |
|
| German |
|
| Spanish |
|
| Norwegian |
|
| Portuguese |
|
| Finnish |
|
| Swedish |
|
| Polish |
|